C16H12Cl2N6O — CID 90183208
2-[8-(3,4-dichlorophenyl)-4,7-dimethylpyrazolo[5,1-c][1,2,4]triazin-3-yl]-5-methyl-1,3,4-oxadiazole (PubChem CID 90183208) has the molecular formula C16H12Cl2N6O and a molecular weight of 375.22 g/mol. Its IUPAC name is 2-[8-(3,4-dichlorophenyl)-4,7-dimethylpyrazolo[5,1-c][1,2,4]triazin-3-yl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[8-(3,4-dichlorophenyl)-4,7-dimethylpyrazolo[5,1-c][1,2,4]triazin-3-yl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 90183208 |
| Molecular Formula | C16H12Cl2N6O |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-[8-(3,4-dichlorophenyl)-4,7-dimethylpyrazolo[5,1-c][1,2,4]triazin-3-yl]-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2nnc3c(-c4ccc(Cl)c(Cl)c4)c(C)nn3c2C)o1 |
| InChI | InChI=1S/C16H12Cl2N6O/c1-7-13(10-4-5-11(17)12(18)6-10)15-21-20-14(8(2)24(15)23-7)16-22-19-9(3)25-16/h4-6H,1-3H3 |
| InChIKey | BZWBFCZDWXDCCB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |