C20H26N10O — CID 90183494
N-[2-[(3R,4R)-3-azido-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridin-6-amine (PubChem CID 90183494) has the molecular formula C20H26N10O and a molecular weight of 422.50 g/mol. Its IUPAC name is N-[2-[(3R,4R)-3-azido-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridin-6-amine.
| Compound Name | N-[2-[(3R,4R)-3-azido-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridin-6-amine |
|---|---|
| PubChem CID | 90183494 |
| Molecular Formula | C20H26N10O |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[2-[(3R,4R)-3-azido-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-2-methyl-1-propan-2-ylimidazo[4,5-c]pyridin-6-amine |
| SMILES | CO[C@@H]1CCN(c2nccc(Nc3cc4c(cn3)nc(C)n4C(C)C)n2)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C20H26N10O/c1-12(2)30-13(3)24-14-10-23-19(9-16(14)30)25-18-5-7-22-20(26-18)29-8-6-17(31-4)15(11-29)27-28-21/h5,7,9-10,12,15,17H,6,8,11H2,1-4H3,(H,22,23,25,26)/t15-,17-/m1/s1 |
| InChIKey | TZJUQKHNUNONBV-NVXWUHKLSA-N |
| XLogP | 3.76 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|