C10H10BrN3O — CID 90183669
11-bromo-3,3-dimethyl-5-oxa-2,7,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),6,8,10-tetraene (PubChem CID 90183669) has the molecular formula C10H10BrN3O and a molecular weight of 268.11 g/mol. Its IUPAC name is 11-bromo-3,3-dimethyl-5-oxa-2,7,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),6,8,10-tetraene.
| Compound Name | 11-bromo-3,3-dimethyl-5-oxa-2,7,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),6,8,10-tetraene |
|---|---|
| PubChem CID | 90183669 |
| Molecular Formula | C10H10BrN3O |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 11-bromo-3,3-dimethyl-5-oxa-2,7,10-triazatricyclo[6.4.0.02,6]dodeca-1(12),6,8,10-tetraene |
| SMILES | CC1(C)COc2nc3cnc(Br)cc3n21 |
| InChI | InChI=1S/C10H10BrN3O/c1-10(2)5-15-9-13-6-4-12-8(11)3-7(6)14(9)10/h3-4H,5H2,1-2H3 |
| InChIKey | VJOVABTWIZLINW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|