C27H38N6 — CID 90183938
1-[3-(2,4-dicyclohexyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)cyclohexen-1-yl]benzotriazole (PubChem CID 90183938) has the molecular formula C27H38N6 and a molecular weight of 446.64 g/mol. Its IUPAC name is 1-[3-(2,4-dicyclohexyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)cyclohexen-1-yl]benzotriazole.
| Compound Name | 1-[3-(2,4-dicyclohexyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)cyclohexen-1-yl]benzotriazole |
|---|---|
| PubChem CID | 90183938 |
| Molecular Formula | C27H38N6 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 1-[3-(2,4-dicyclohexyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)cyclohexen-1-yl]benzotriazole |
| SMILES | C1=C(n2nnc3ccccc32)CCCC1C1=NC(C2CCCCC2)NC(C2CCCCC2)N1 |
| InChI | InChI=1S/C27H38N6/c1-3-10-19(11-4-1)25-28-26(20-12-5-2-6-13-20)30-27(29-25)21-14-9-15-22(18-21)33-24-17-8-7-16-23(24)31-32-33/h7-8,16-21,25-26,28H,1-6,9-15H2,(H,29,30) |
| InChIKey | UJVIVRKLFZJIIN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |