About 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one
1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one (PubChem CID 90184126) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one.
Molecular Properties
| Compound Name | 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one |
| PubChem CID | 90184126 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one |
| SMILES | C=C/C=C(\C)C1=CCN(CCC(=O)CC)CC1 |
| InChI | InChI=1S/C15H23NO/c1-4-6-13(3)14-7-10-16(11-8-14)12-9-15(17)5-2/h4,6-7H,1,5,8-12H2,2-3H3/b13-6+ |
| InChIKey | BQVGBLRMHCHZBZ-AWNIVKPZSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one?
The IUPAC name of 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one (CID 90184126) is 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one.
What is the SMILES notation for 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one?
The canonical SMILES for 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one is C=C/C=C(\C)C1=CCN(CCC(=O)CC)CC1.
What is the InChIKey of 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one?
The InChIKey is BQVGBLRMHCHZBZ-AWNIVKPZSA-N. The full InChI is InChI=1S/C15H23NO/c1-4-6-13(3)14-7-10-16(11-8-14)12-9-15(17)5-2/h4,6-7H,1,5,8-12H2,2-3H3/b13-6+.
What are the key properties of 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one?
1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one has a molecular weight of 233.35 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(2E)-penta-2,4-dien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]pentan-3-one is sourced from PubChem (CID 90184126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).