C14H28N2 — CID 90184398
(7E,11Z)-9-methyltrideca-7,11-diene-4,7-diamine (PubChem CID 90184398) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (7E,11Z)-9-methyltrideca-7,11-diene-4,7-diamine.
| Compound Name | (7E,11Z)-9-methyltrideca-7,11-diene-4,7-diamine |
|---|---|
| PubChem CID | 90184398 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (7E,11Z)-9-methyltrideca-7,11-diene-4,7-diamine |
| SMILES | C/C=C\CC(C)/C=C(/N)CCC(N)CCC |
| InChI | InChI=1S/C14H28N2/c1-4-6-8-12(3)11-14(16)10-9-13(15)7-5-2/h4,6,11-13H,5,7-10,15-16H2,1-3H3/b6-4-,14-11+ |
| InChIKey | KCXVUAVWHPYMOY-QNQUXMIPSA-N |
| XLogP | 3.34 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|