C18H20BF3N4O2 — CID 90184858
5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 90184858) has the molecular formula C18H20BF3N4O2 and a molecular weight of 392.19 g/mol. Its IUPAC name is 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 90184858 |
| Molecular Formula | C18H20BF3N4O2 |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1cnc2[nH]c(B3OC(C)(C)C(C)(C)O3)cc2c1 |
| InChI | InChI=1S/C18H20BF3N4O2/c1-16(2)17(3,4)28-19(27-16)14-7-10-6-11(9-23-15(10)24-14)12-8-13(18(20,21)22)25-26(12)5/h6-9H,1-5H3,(H,23,24) |
| InChIKey | KTABVOYKSKAQON-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|