C19H27Cl2N3O2S — CID 90185071
[2-[[4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylphenyl]methyl]-1,3-thiazol-4-yl]methyl acetate;dihydrochloride (PubChem CID 90185071) has the molecular formula C19H27Cl2N3O2S and a molecular weight of 432.42 g/mol. Its IUPAC name is [2-[[4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylphenyl]methyl]-1,3-thiazol-4-yl]methyl acetate;dihydrochloride.
| Compound Name | [2-[[4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylphenyl]methyl]-1,3-thiazol-4-yl]methyl acetate;dihydrochloride |
|---|---|
| PubChem CID | 90185071 |
| Molecular Formula | C19H27Cl2N3O2S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [2-[[4-[[ethyl(methyl)amino]methylideneamino]-2,5-dimethylphenyl]methyl]-1,3-thiazol-4-yl]methyl acetate;dihydrochloride |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(COC(C)=O)cs2)cc1C.Cl.Cl |
| InChI | InChI=1S/C19H25N3O2S.2ClH/c1-6-22(5)12-20-18-8-13(2)16(7-14(18)3)9-19-21-17(11-25-19)10-24-15(4)23;;/h7-8,11-12H,6,9-10H2,1-5H3;2*1H/b20-12+;; |
| InChIKey | XFYHMUFIKCCQCA-FPIMHUBQSA-N |
| XLogP | 4.87 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|