C23H24F3N3S — CID 90185180
N'-[2,5-dimethyl-4-[[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 90185180) has the molecular formula C23H24F3N3S and a molecular weight of 431.53 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 90185180 |
| Molecular Formula | C23H24F3N3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N'-[2,5-dimethyl-4-[[4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(-c3ccc(C(F)(F)F)cc3)cs2)cc1C |
| InChI | InChI=1S/C23H24F3N3S/c1-5-29(4)14-27-20-11-15(2)18(10-16(20)3)12-22-28-21(13-30-22)17-6-8-19(9-7-17)23(24,25)26/h6-11,13-14H,5,12H2,1-4H3/b27-14+ |
| InChIKey | AWKORVCJJJKHSE-MZJWZYIUSA-N |
| XLogP | 6.65 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|