About 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride
3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride (PubChem CID 90185727) has the molecular formula C12H17Cl2N3O3
and a molecular weight of 322.19 g/mol. Its IUPAC name is 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride.
Molecular Properties
| Compound Name | 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride |
| PubChem CID | 90185727 |
| Molecular Formula | C12H17Cl2N3O3 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride |
| SMILES | CCCON1C(=O)C(N)C(=O)Nc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C12H15N3O3.2ClH/c1-2-7-18-15-9-6-4-3-5-8(9)14-11(16)10(13)12(15)17;;/h3-6,10H,2,7,13H2,1H3,(H,14,16);2*1H |
| InChIKey | CYQGAFMJRIPLBQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride?
The IUPAC name of 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride (CID 90185727) is 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride.
What is the SMILES notation for 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride?
The canonical SMILES for 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride is CCCON1C(=O)C(N)C(=O)Nc2ccccc21.Cl.Cl.
What is the InChIKey of 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride?
The InChIKey is CYQGAFMJRIPLBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3.2ClH/c1-2-7-18-15-9-6-4-3-5-8(9)14-11(16)10(13)12(15)17;;/h3-6,10H,2,7,13H2,1H3,(H,14,16);2*1H.
What are the key properties of 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride?
3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride has a molecular weight of 322.19 g/mol, XLogP of 1.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-propoxy-1H-1,5-benzodiazepine-2,4-dione;dihydrochloride is sourced from PubChem (CID 90185727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).