C18H14F2N4O2 — CID 90185993
(E)-2-[2-(2,6-difluorophenyl)-1,3-oxazol-4-yl]-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxyprop-2-enenitrile (PubChem CID 90185993) has the molecular formula C18H14F2N4O2 and a molecular weight of 356.33 g/mol. Its IUPAC name is (E)-2-[2-(2,6-difluorophenyl)-1,3-oxazol-4-yl]-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxyprop-2-enenitrile.
| Compound Name | (E)-2-[2-(2,6-difluorophenyl)-1,3-oxazol-4-yl]-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxyprop-2-enenitrile |
|---|---|
| PubChem CID | 90185993 |
| Molecular Formula | C18H14F2N4O2 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (E)-2-[2-(2,6-difluorophenyl)-1,3-oxazol-4-yl]-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxyprop-2-enenitrile |
| SMILES | CCn1nc(C)cc1/C(O)=C(\C#N)c1coc(-c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C18H14F2N4O2/c1-3-24-15(7-10(2)23-24)17(25)11(8-21)14-9-26-18(22-14)16-12(19)5-4-6-13(16)20/h4-7,9,25H,3H2,1-2H3/b17-11- |
| InChIKey | UKCVQPJVKOQDLZ-BOPFTXTBSA-N |
| XLogP | 4.09 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|