C21H20ClNO5 — CID 9018605
[2-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 9018605) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is [2-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9018605 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [2-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)COC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClNO5/c1-2-23(12-16-5-9-18-19(11-16)28-14-27-18)20(24)13-26-21(25)10-6-15-3-7-17(22)8-4-15/h3-11H,2,12-14H2,1H3/b10-6+ |
| InChIKey | OEGCWZNFAXGIDF-UXBLZVDNSA-N |
| XLogP | 3.67 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|