About (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide
(Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide (PubChem CID 90186144) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide.
Molecular Properties
| Compound Name | (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide |
| PubChem CID | 90186144 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide |
| SMILES | NC(=O)/C=C\C(=O)NCC1CO1 |
| InChI | InChI=1S/C7H10N2O3/c8-6(10)1-2-7(11)9-3-5-4-12-5/h1-2,5H,3-4H2,(H2,8,10)(H,9,11)/b2-1- |
| InChIKey | JGDYDPGHXVFWIU-UPHRSURJSA-N |
| XLogP | -1.46 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide?
The IUPAC name of (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide (CID 90186144) is (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide.
What is the SMILES notation for (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide?
The canonical SMILES for (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide is NC(=O)/C=C\C(=O)NCC1CO1.
What is the InChIKey of (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide?
The InChIKey is JGDYDPGHXVFWIU-UPHRSURJSA-N. The full InChI is InChI=1S/C7H10N2O3/c8-6(10)1-2-7(11)9-3-5-4-12-5/h1-2,5H,3-4H2,(H2,8,10)(H,9,11)/b2-1-.
What are the key properties of (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide?
(Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide has a molecular weight of 170.17 g/mol, XLogP of -1.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-(oxiran-2-ylmethyl)but-2-enediamide is sourced from PubChem (CID 90186144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).