About 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine
2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine (PubChem CID 90186317) has the molecular formula C22H18N4O
and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine |
| PubChem CID | 90186317 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine |
| SMILES | COCc1ncc(-c2ccccn2)c(-c2ccccn2)c1-c1ccccn1 |
| InChI | InChI=1S/C22H18N4O/c1-27-15-20-22(19-10-4-7-13-25-19)21(18-9-3-6-12-24-18)16(14-26-20)17-8-2-5-11-23-17/h2-14H,15H2,1H3 |
| InChIKey | TUMYESFWDJNUIW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine?
The IUPAC name of 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine (CID 90186317) is 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine.
What is the SMILES notation for 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine?
The canonical SMILES for 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine is COCc1ncc(-c2ccccn2)c(-c2ccccn2)c1-c1ccccn1.
What is the InChIKey of 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine?
The InChIKey is TUMYESFWDJNUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O/c1-27-15-20-22(19-10-4-7-13-25-19)21(18-9-3-6-12-24-18)16(14-26-20)17-8-2-5-11-23-17/h2-14H,15H2,1H3.
What are the key properties of 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine?
2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine has a molecular weight of 354.41 g/mol, XLogP of 4.41, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-3,4,5-tripyridin-2-ylpyridine is sourced from PubChem (CID 90186317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).