C23H22F3N7O3 — CID 90187352
1-(2-methylphenyl)-N-[(3S)-1-pyrrolo[1,2-a]pyrazin-1-ylpyrrolidin-3-yl]-1,2,4-triazole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 90187352) has the molecular formula C23H22F3N7O3 and a molecular weight of 501.47 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N-[(3S)-1-pyrrolo[1,2-a]pyrazin-1-ylpyrrolidin-3-yl]-1,2,4-triazole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(2-methylphenyl)-N-[(3S)-1-pyrrolo[1,2-a]pyrazin-1-ylpyrrolidin-3-yl]-1,2,4-triazole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90187352 |
| Molecular Formula | C23H22F3N7O3 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 1-(2-methylphenyl)-N-[(3S)-1-pyrrolo[1,2-a]pyrazin-1-ylpyrrolidin-3-yl]-1,2,4-triazole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccccc1-n1cnc(C(=O)N[C@H]2CCN(c3nccn4cccc34)C2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H21N7O.C2HF3O2/c1-15-5-2-3-6-17(15)28-14-23-19(25-28)21(29)24-16-8-11-27(13-16)20-18-7-4-10-26(18)12-9-22-20;3-2(4,5)1(6)7/h2-7,9-10,12,14,16H,8,11,13H2,1H3,(H,24,29);(H,6,7)/t16-;/m0./s1 |
| InChIKey | FMNHRHFMQNQIHR-NTISSMGPSA-N |
| XLogP | 2.87 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |