C20H25F3N2O7S — CID 90187353
(2,2,2-trifluoroacetyl) 2-(cyclopropylmethoxy)-4-[methylsulfonyl(2-morpholin-4-ylethyl)amino]benzoate (PubChem CID 90187353) has the molecular formula C20H25F3N2O7S and a molecular weight of 494.49 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-(cyclopropylmethoxy)-4-[methylsulfonyl(2-morpholin-4-ylethyl)amino]benzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-(cyclopropylmethoxy)-4-[methylsulfonyl(2-morpholin-4-ylethyl)amino]benzoate |
|---|---|
| PubChem CID | 90187353 |
| Molecular Formula | C20H25F3N2O7S |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-(cyclopropylmethoxy)-4-[methylsulfonyl(2-morpholin-4-ylethyl)amino]benzoate |
| SMILES | CS(=O)(=O)N(CCN1CCOCC1)c1ccc(C(=O)OC(=O)C(F)(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C20H25F3N2O7S/c1-33(28,29)25(7-6-24-8-10-30-11-9-24)15-4-5-16(17(12-15)31-13-14-2-3-14)18(26)32-19(27)20(21,22)23/h4-5,12,14H,2-3,6-11,13H2,1H3 |
| InChIKey | GGKXQLFFIXMHGW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|