About fluoromethanesulfinate;dihydrochloride
fluoromethanesulfinate;dihydrochloride (PubChem CID 90187443) has the molecular formula CH4Cl2FO2S-
and a molecular weight of 170.01 g/mol. Its IUPAC name is fluoromethanesulfinate;dihydrochloride.
Molecular Properties
| Compound Name | fluoromethanesulfinate;dihydrochloride |
| PubChem CID | 90187443 |
| Molecular Formula | CH4Cl2FO2S- |
| Molecular Weight | 170.01 g/mol |
| Exact Mass | 168.93 |
| IUPAC Name | fluoromethanesulfinate;dihydrochloride |
| SMILES | Cl.Cl.O=S([O-])CF |
| InChI | InChI=1S/CH3FO2S.2ClH/c2-1-5(3)4;;/h1H2,(H,3,4);2*1H/p-1 |
| InChIKey | MQYNIRWWRMSAND-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.01 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze fluoromethanesulfinate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethanesulfinate;dihydrochloride?
The IUPAC name of fluoromethanesulfinate;dihydrochloride (CID 90187443) is fluoromethanesulfinate;dihydrochloride.
What is the SMILES notation for fluoromethanesulfinate;dihydrochloride?
The canonical SMILES for fluoromethanesulfinate;dihydrochloride is Cl.Cl.O=S([O-])CF.
What is the InChIKey of fluoromethanesulfinate;dihydrochloride?
The InChIKey is MQYNIRWWRMSAND-UHFFFAOYSA-M. The full InChI is InChI=1S/CH3FO2S.2ClH/c2-1-5(3)4;;/h1H2,(H,3,4);2*1H/p-1.
What are the key properties of fluoromethanesulfinate;dihydrochloride?
fluoromethanesulfinate;dihydrochloride has a molecular weight of 170.01 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethanesulfinate;dihydrochloride is sourced from PubChem (CID 90187443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).