C37H38Cl2N4O9 — CID 90188044
[(1S)-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonyl-pyridin-3-ylamino]methyl]benzoate formate (PubChem CID 90188044) has the molecular formula C37H38Cl2N4O9 and a molecular weight of 753.64 g/mol. Its IUPAC name is [(1S)-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonyl-pyridin-3-ylamino]methyl]benzoate formate.
| Compound Name | [(1S)-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonyl-pyridin-3-ylamino]methyl]benzoate formate |
|---|---|
| PubChem CID | 90188044 |
| Molecular Formula | C37H38Cl2N4O9 |
| Molecular Weight | 753.64 g/mol |
| Exact Mass | 752.20 |
| IUPAC Name | [(1S)-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 3-[[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxycarbonyl-pyridin-3-ylamino]methyl]benzoate formate |
| SMILES | COc1ccc([C@H](Cc2c(Cl)c[n+](O)cc2Cl)OC(=O)c2cccc(CN(C(=O)O[C@H]3CN4CCC3CC4)c3cccnc3)c2)cc1OC.O=C[O-] |
| InChI | InChI=1S/C36H37Cl2N4O7.CH2O2/c1-46-31-9-8-25(16-33(31)47-2)32(17-28-29(37)20-41(45)21-30(28)38)48-35(43)26-6-3-5-23(15-26)19-42(27-7-4-12-39-18-27)36(44)49-34-22-40-13-10-24(34)11-14-40;2-1-3/h3-9,12,15-16,18,20-21,24,32,34,45H,10-11,13-14,17,19,22H2,1-2H3;1H,(H,2,3)/q+1;/p-1/t32-,34-;/m0./s1 |
| InChIKey | XWNCWVPVOHWLLZ-ULZLXOIVSA-M |
| XLogP | 4.67 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|