C13HF9 — CID 90188219
1,2,3,4,5,6,7,8,9-nonafluoro-1H-fluorene (PubChem CID 90188219) has the molecular formula C13HF9 and a molecular weight of 328.13 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9-nonafluoro-1H-fluorene.
| Compound Name | 1,2,3,4,5,6,7,8,9-nonafluoro-1H-fluorene |
|---|---|
| PubChem CID | 90188219 |
| Molecular Formula | C13HF9 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9-nonafluoro-1H-fluorene |
| SMILES | FC1=C2C(=C(F)c3c(F)c(F)c(F)c(F)c32)C(F)C(F)=C1F |
| InChI | InChI=1S/C13HF9/c14-5-3-1(6(15)10(19)12(21)8(3)17)2-4(5)9(18)13(22)11(20)7(2)16/h8H |
| InChIKey | VEHJARXFQVETKC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|