About (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one
(2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one (PubChem CID 901884) has the molecular formula C15H7Cl3O2
and a molecular weight of 325.58 g/mol. Its IUPAC name is (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one.
Molecular Properties
| Compound Name | (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one |
| PubChem CID | 901884 |
| Molecular Formula | C15H7Cl3O2 |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C\c2ccccc2Cl)Oc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C15H7Cl3O2/c16-9-6-10-14(19)13(20-15(10)12(18)7-9)5-8-3-1-2-4-11(8)17/h1-7H/b13-5+ |
| InChIKey | RKJPQXCIKCEOLZ-WLRTZDKTSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one?
The IUPAC name of (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one (CID 901884) is (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one.
What is the SMILES notation for (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one?
The canonical SMILES for (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one is O=C1/C(=C\c2ccccc2Cl)Oc2c(Cl)cc(Cl)cc21.
What is the InChIKey of (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one?
The InChIKey is RKJPQXCIKCEOLZ-WLRTZDKTSA-N. The full InChI is InChI=1S/C15H7Cl3O2/c16-9-6-10-14(19)13(20-15(10)12(18)7-9)5-8-3-1-2-4-11(8)17/h1-7H/b13-5+.
What are the key properties of (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one?
(2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one has a molecular weight of 325.58 g/mol, XLogP of 5.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5,7-dichloro-2-[(2-chlorophenyl)methylidene]-1-benzofuran-3-one is sourced from PubChem (CID 901884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).