C24H22N4O2 — CID 90188646
1-(20-acetyl-2,3,12,13,22,24-hexahydroporphyrin-5-yl)ethanone (PubChem CID 90188646) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-(20-acetyl-2,3,12,13,22,24-hexahydroporphyrin-5-yl)ethanone.
| Compound Name | 1-(20-acetyl-2,3,12,13,22,24-hexahydroporphyrin-5-yl)ethanone |
|---|---|
| PubChem CID | 90188646 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-(20-acetyl-2,3,12,13,22,24-hexahydroporphyrin-5-yl)ethanone |
| SMILES | CC(=O)c1c2nc(c(C(C)=O)c3ccc(cc4nc(cc5ccc1[nH]5)CC4)[nH]3)CC2 |
| InChI | InChI=1S/C24H22N4O2/c1-13(29)23-19-7-5-17(26-19)11-15-3-4-16(25-15)12-18-6-8-20(27-18)24(14(2)30)22-10-9-21(23)28-22/h5-8,11-12,26-27H,3-4,9-10H2,1-2H3/b15-11-,16-12-,17-11-,18-12-,23-19-,23-21-,24-20-,24-22- |
| InChIKey | SITKVURQBPJBTL-ABJDLBHNSA-N |
| XLogP | 4.29 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |