C25H29F3O4S — CID 90189048
methyl 5-hydroxy-5-methyl-3-oxo-7-[4-(trifluoromethyl)phenyl]sulfanyl-2-(2,4,6-trimethylphenyl)heptanoate (PubChem CID 90189048) has the molecular formula C25H29F3O4S and a molecular weight of 482.56 g/mol. Its IUPAC name is methyl 5-hydroxy-5-methyl-3-oxo-7-[4-(trifluoromethyl)phenyl]sulfanyl-2-(2,4,6-trimethylphenyl)heptanoate.
| Compound Name | methyl 5-hydroxy-5-methyl-3-oxo-7-[4-(trifluoromethyl)phenyl]sulfanyl-2-(2,4,6-trimethylphenyl)heptanoate |
|---|---|
| PubChem CID | 90189048 |
| Molecular Formula | C25H29F3O4S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | methyl 5-hydroxy-5-methyl-3-oxo-7-[4-(trifluoromethyl)phenyl]sulfanyl-2-(2,4,6-trimethylphenyl)heptanoate |
| SMILES | COC(=O)C(C(=O)CC(C)(O)CCSc1ccc(C(F)(F)F)cc1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H29F3O4S/c1-15-12-16(2)21(17(3)13-15)22(23(30)32-5)20(29)14-24(4,31)10-11-33-19-8-6-18(7-9-19)25(26,27)28/h6-9,12-13,22,31H,10-11,14H2,1-5H3 |
| InChIKey | LQKDAGGLEPUDHF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|