About 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide
4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide (PubChem CID 90189451) has the molecular formula C20H23F3N2OS
and a molecular weight of 396.48 g/mol. Its IUPAC name is 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide |
| PubChem CID | 90189451 |
| Molecular Formula | C20H23F3N2OS |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide |
| SMILES | CC(C)CCNC(=O)c1cc(SCCC(F)(F)c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C20H23F3N2OS/c1-14(2)7-10-25-19(26)18-13-17(8-11-24-18)27-12-9-20(22,23)15-3-5-16(21)6-4-15/h3-6,8,11,13-14H,7,9-10,12H2,1-2H3,(H,25,26) |
| InChIKey | AGFZBEFZOXFHHG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide?
The IUPAC name of 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide (CID 90189451) is 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide.
What is the SMILES notation for 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide?
The canonical SMILES for 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide is CC(C)CCNC(=O)c1cc(SCCC(F)(F)c2ccc(F)cc2)ccn1.
What is the InChIKey of 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide?
The InChIKey is AGFZBEFZOXFHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F3N2OS/c1-14(2)7-10-25-19(26)18-13-17(8-11-24-18)27-12-9-20(22,23)15-3-5-16(21)6-4-15/h3-6,8,11,13-14H,7,9-10,12H2,1-2H3,(H,25,26).
What are the key properties of 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide?
4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide has a molecular weight of 396.48 g/mol, XLogP of 5.27, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,3-difluoro-3-(4-fluorophenyl)propyl]sulfanyl-N-(3-methylbutyl)pyridine-2-carboxamide is sourced from PubChem (CID 90189451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).