C19H24ClN7O2S — CID 90189505
N-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 90189505) has the molecular formula C19H24ClN7O2S and a molecular weight of 449.97 g/mol. Its IUPAC name is N-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 90189505 |
| Molecular Formula | C19H24ClN7O2S |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[2-[[2-amino-6-(2,3-dimethylphenyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1cccc(-c2cc(NCCNS(=O)(=O)c3c(C)nn(C)c3Cl)nc(N)n2)c1C |
| InChI | InChI=1S/C19H24ClN7O2S/c1-11-6-5-7-14(12(11)2)15-10-16(25-19(21)24-15)22-8-9-23-30(28,29)17-13(3)26-27(4)18(17)20/h5-7,10,23H,8-9H2,1-4H3,(H3,21,22,24,25) |
| InChIKey | KAGDXJKNYHAZIT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|