C18H11ClF2N4OS — CID 90189962
[5-[[(2R,3S)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazol-3-yl] thiocyanate (PubChem CID 90189962) has the molecular formula C18H11ClF2N4OS and a molecular weight of 404.83 g/mol. Its IUPAC name is [5-[[(2R,3S)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazol-3-yl] thiocyanate.
| Compound Name | [5-[[(2R,3S)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazol-3-yl] thiocyanate |
|---|---|
| PubChem CID | 90189962 |
| Molecular Formula | C18H11ClF2N4OS |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | [5-[[(2R,3S)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazol-3-yl] thiocyanate |
| SMILES | N#CSc1n[nH]c(C[C@]2(c3ccc(F)cc3F)O[C@H]2c2ccccc2Cl)n1 |
| InChI | InChI=1S/C18H11ClF2N4OS/c19-13-4-2-1-3-11(13)16-18(26-16,12-6-5-10(20)7-14(12)21)8-15-23-17(25-24-15)27-9-22/h1-7,16H,8H2,(H,23,24,25)/t16-,18+/m0/s1 |
| InChIKey | QFFALVNLQSWBDE-FUHWJXTLSA-N |
| XLogP | 4.52 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|