C30H36N6O2S — CID 90190083
5-[4-[4-[2-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]ethyl]piperazin-1-yl]phenyl]-1H-indole-2,3-dione (PubChem CID 90190083) has the molecular formula C30H36N6O2S and a molecular weight of 544.73 g/mol. Its IUPAC name is 5-[4-[4-[2-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]ethyl]piperazin-1-yl]phenyl]-1H-indole-2,3-dione.
| Compound Name | 5-[4-[4-[2-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]ethyl]piperazin-1-yl]phenyl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 90190083 |
| Molecular Formula | C30H36N6O2S |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 5-[4-[4-[2-[(2-amino-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)-propylamino]ethyl]piperazin-1-yl]phenyl]-1H-indole-2,3-dione |
| SMILES | CCCN(CCN1CCN(c2ccc(-c3ccc4c(c3)C(=O)C(=O)N4)cc2)CC1)C1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C30H36N6O2S/c1-2-11-35(23-8-10-26-27(19-23)39-30(31)33-26)15-12-34-13-16-36(17-14-34)22-6-3-20(4-7-22)21-5-9-25-24(18-21)28(37)29(38)32-25/h3-7,9,18,23H,2,8,10-17,19H2,1H3,(H2,31,33)(H,32,37,38) |
| InChIKey | YORDCBBJXGVKQY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|