C6H10BrN — CID 90190086
6-bromo-3-methyl-1,2,3,4-tetrahydropyridine (PubChem CID 90190086) has the molecular formula C6H10BrN and a molecular weight of 176.06 g/mol. Its IUPAC name is 6-bromo-3-methyl-1,2,3,4-tetrahydropyridine.
| Compound Name | 6-bromo-3-methyl-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 90190086 |
| Molecular Formula | C6H10BrN |
| Molecular Weight | 176.06 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | 6-bromo-3-methyl-1,2,3,4-tetrahydropyridine |
| SMILES | CC1CC=C(Br)NC1 |
| InChI | InChI=1S/C6H10BrN/c1-5-2-3-6(7)8-4-5/h3,5,8H,2,4H2,1H3 |
| InChIKey | FXCRPSAERKLSJS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.06 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|