About 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol
4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol (PubChem CID 90190832) has the molecular formula C9H8BrClO
and a molecular weight of 249.53 g/mol. Its IUPAC name is 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol.
Molecular Properties
| Compound Name | 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol |
| PubChem CID | 90190832 |
| Molecular Formula | C9H8BrClO |
| Molecular Weight | 249.53 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol |
| SMILES | [2H]C([2H])(C=C)c1cc(Br)cc(Cl)c1O |
| InChI | InChI=1S/C9H8BrClO/c1-2-3-6-4-7(10)5-8(11)9(6)12/h2,4-5,12H,1,3H2/i3D2 |
| InChIKey | OIJACWUOKJSWKL-SMZGMGDZSA-N |
| XLogP | 3.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol?
The IUPAC name of 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol (CID 90190832) is 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol.
What is the SMILES notation for 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol?
The canonical SMILES for 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol is [2H]C([2H])(C=C)c1cc(Br)cc(Cl)c1O.
What is the InChIKey of 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol?
The InChIKey is OIJACWUOKJSWKL-SMZGMGDZSA-N. The full InChI is InChI=1S/C9H8BrClO/c1-2-3-6-4-7(10)5-8(11)9(6)12/h2,4-5,12H,1,3H2/i3D2.
What are the key properties of 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol?
4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol has a molecular weight of 249.53 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-chloro-6-(1,1-dideuterioprop-2-enyl)phenol is sourced from PubChem (CID 90190832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).