C20H18F3N5O3 — CID 90191215
3-[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 90191215) has the molecular formula C20H18F3N5O3 and a molecular weight of 433.39 g/mol. Its IUPAC name is 3-[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 3-[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 90191215 |
| Molecular Formula | C20H18F3N5O3 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | C=CCOc1cccc(Nc2nc(Nc3cccc(O)c3)nc(OCC(F)(F)F)n2)c1 |
| InChI | InChI=1S/C20H18F3N5O3/c1-2-9-30-16-8-4-6-14(11-16)25-18-26-17(24-13-5-3-7-15(29)10-13)27-19(28-18)31-12-20(21,22)23/h2-8,10-11,29H,1,9,12H2,(H2,24,25,26,27,28) |
| InChIKey | LCCYTEPHVDOBRF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|