About CID 90191234
CID 90191234 (PubChem CID 90191234) has the molecular formula C14H30BO14P3
and a molecular weight of 526.11 g/mol.
Molecular Properties
| Compound Name | CID 90191234 |
| PubChem CID | 90191234 |
| Molecular Formula | C14H30BO14P3 |
| Molecular Weight | 526.11 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | — |
| SMILES | [B]C1CC(OP(=O)(O)OCCCOP(=O)(O)OCCCOP(=O)(O)OCCCO)C(C)O1 |
| InChI | InChI=1S/C14H30BO14P3/c1-12-13(11-14(15)28-12)29-32(21,22)27-10-4-9-26-31(19,20)25-8-3-7-24-30(17,18)23-6-2-5-16/h12-14,16H,2-11H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | CSVOPMGBHFBFCO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 196.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.11 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 90191234 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90191234?
The IUPAC name of CID 90191234 (CID 90191234) is not available.
What is the SMILES notation for CID 90191234?
The canonical SMILES for CID 90191234 is [B]C1CC(OP(=O)(O)OCCCOP(=O)(O)OCCCOP(=O)(O)OCCCO)C(C)O1.
What is the InChIKey of CID 90191234?
The InChIKey is CSVOPMGBHFBFCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30BO14P3/c1-12-13(11-14(15)28-12)29-32(21,22)27-10-4-9-26-31(19,20)25-8-3-7-24-30(17,18)23-6-2-5-16/h12-14,16H,2-11H2,1H3,(H,17,18)(H,19,20)(H,21,22).
What are the key properties of CID 90191234?
CID 90191234 has a molecular weight of 526.11 g/mol, XLogP of 1.22, 18 rotatable bonds, 4 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90191234 is sourced from PubChem (CID 90191234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).