C25H22Cl2F2N2O4 — CID 90192446
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] 4-aminobenzoate (PubChem CID 90192446) has the molecular formula C25H22Cl2F2N2O4 and a molecular weight of 523.36 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] 4-aminobenzoate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 90192446 |
| Molecular Formula | C25H22Cl2F2N2O4 |
| Molecular Weight | 523.36 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)O[C@@H](Cc2c(Cl)cncc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1 |
| InChI | InChI=1S/C25H22Cl2F2N2O4/c26-19-11-31-12-20(27)18(19)10-22(34-24(32)15-3-6-17(30)7-4-15)16-5-8-21(35-25(28)29)23(9-16)33-13-14-1-2-14/h3-9,11-12,14,22,25H,1-2,10,13,30H2/t22-/m0/s1 |
| InChIKey | HZGNOGUNUWOEJB-QFIPXVFZSA-N |
| XLogP | 6.50 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.36 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|