About N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide
N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide (PubChem CID 90192786) has the molecular formula C10H8F2N4O
and a molecular weight of 238.20 g/mol. Its IUPAC name is N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide.
Molecular Properties
| Compound Name | N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide |
| PubChem CID | 90192786 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide |
| SMILES | O=CNc1cn(Cc2c(F)cccc2F)nn1 |
| InChI | InChI=1S/C10H8F2N4O/c11-8-2-1-3-9(12)7(8)4-16-5-10(13-6-17)14-15-16/h1-3,5-6H,4H2,(H,13,17) |
| InChIKey | LGRXLFMBAXRACM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide?
The IUPAC name of N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide (CID 90192786) is N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide.
What is the SMILES notation for N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide?
The canonical SMILES for N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide is O=CNc1cn(Cc2c(F)cccc2F)nn1.
What is the InChIKey of N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide?
The InChIKey is LGRXLFMBAXRACM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2N4O/c11-8-2-1-3-9(12)7(8)4-16-5-10(13-6-17)14-15-16/h1-3,5-6H,4H2,(H,13,17).
What are the key properties of N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide?
N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide has a molecular weight of 238.20 g/mol, XLogP of 1.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]formamide is sourced from PubChem (CID 90192786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).