About [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid
[7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid (PubChem CID 90193034) has the molecular formula C23H27O6P
and a molecular weight of 430.44 g/mol. Its IUPAC name is [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid.
Molecular Properties
| Compound Name | [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid |
| PubChem CID | 90193034 |
| Molecular Formula | C23H27O6P |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid |
| SMILES | COC1(c2ccc3cccc(OP(C)(=O)O)c3c2)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C23H27O6P/c1-26-23(22(28-29-23)18-9-14-8-15(11-18)12-19(22)10-14)17-7-6-16-4-3-5-21(20(16)13-17)27-30(2,24)25/h3-7,13-15,18-19H,8-12H2,1-2H3,(H,24,25) |
| InChIKey | OZNIMFKAIJQRJO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid?
The IUPAC name of [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid (CID 90193034) is [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid.
What is the SMILES notation for [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid?
The canonical SMILES for [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid is COC1(c2ccc3cccc(OP(C)(=O)O)c3c2)OOC12C1CC3CC(C1)CC2C3.
What is the InChIKey of [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid?
The InChIKey is OZNIMFKAIJQRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27O6P/c1-26-23(22(28-29-23)18-9-14-8-15(11-18)12-19(22)10-14)17-7-6-16-4-3-5-21(20(16)13-17)27-30(2,24)25/h3-7,13-15,18-19H,8-12H2,1-2H3,(H,24,25).
What are the key properties of [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid?
[7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid has a molecular weight of 430.44 g/mol, XLogP of 4.99, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)naphthalen-1-yl]oxy-methylphosphinic acid is sourced from PubChem (CID 90193034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).