C17H15F3OS — CID 90193111
S-[4-methyl-3-(trifluoromethyl)phenyl] 3,4-dimethylbenzenecarbothioate (PubChem CID 90193111) has the molecular formula C17H15F3OS and a molecular weight of 324.37 g/mol. Its IUPAC name is S-[4-methyl-3-(trifluoromethyl)phenyl] 3,4-dimethylbenzenecarbothioate.
| Compound Name | S-[4-methyl-3-(trifluoromethyl)phenyl] 3,4-dimethylbenzenecarbothioate |
|---|---|
| PubChem CID | 90193111 |
| Molecular Formula | C17H15F3OS |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | S-[4-methyl-3-(trifluoromethyl)phenyl] 3,4-dimethylbenzenecarbothioate |
| SMILES | Cc1ccc(C(=O)Sc2ccc(C)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C17H15F3OS/c1-10-4-6-13(8-12(10)3)16(21)22-14-7-5-11(2)15(9-14)17(18,19)20/h4-9H,1-3H3 |
| InChIKey | CJZDBFIXTGUQEB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|