About 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile
6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile (PubChem CID 90193139) has the molecular formula C8H6N2OS
and a molecular weight of 178.22 g/mol. Its IUPAC name is 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile.
Molecular Properties
| Compound Name | 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile |
| PubChem CID | 90193139 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile |
| SMILES | N#CC1Nc2ccc(O)cc2S1 |
| InChI | InChI=1S/C8H6N2OS/c9-4-8-10-6-2-1-5(11)3-7(6)12-8/h1-3,8,10-11H |
| InChIKey | LLHCITSUGOBVTR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile?
The IUPAC name of 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile (CID 90193139) is 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile.
What is the SMILES notation for 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile?
The canonical SMILES for 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile is N#CC1Nc2ccc(O)cc2S1.
What is the InChIKey of 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile?
The InChIKey is LLHCITSUGOBVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2OS/c9-4-8-10-6-2-1-5(11)3-7(6)12-8/h1-3,8,10-11H.
What are the key properties of 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile?
6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile has a molecular weight of 178.22 g/mol, XLogP of 1.76, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,3-dihydro-1,3-benzothiazole-2-carbonitrile is sourced from PubChem (CID 90193139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).