C9H15N7S2 — CID 90193581
(1R)-2-[[(2R)-2-amino-2-(4H-imidazol-2-yl)ethyl]disulfanyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 90193581) has the molecular formula C9H15N7S2 and a molecular weight of 285.40 g/mol. Its IUPAC name is (1R)-2-[[(2R)-2-amino-2-(4H-imidazol-2-yl)ethyl]disulfanyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | (1R)-2-[[(2R)-2-amino-2-(4H-imidazol-2-yl)ethyl]disulfanyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 90193581 |
| Molecular Formula | C9H15N7S2 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (1R)-2-[[(2R)-2-amino-2-(4H-imidazol-2-yl)ethyl]disulfanyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | N[C@@H](CSSC[C@H](N)c1ncn[nH]1)C1=NCC=N1 |
| InChI | InChI=1S/C9H15N7S2/c10-6(8-12-1-2-13-8)3-17-18-4-7(11)9-14-5-15-16-9/h1,5-7H,2-4,10-11H2,(H,14,15,16)/t6-,7-/m0/s1 |
| InChIKey | LXCXGZSRKLGIPZ-BQBZGAKWSA-N |
| XLogP | -0.00 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|