C12H22N8S2 — CID 90193582
(1R)-2-[[(2R)-2-amino-2-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]disulfanyl]-1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanamine (PubChem CID 90193582) has the molecular formula C12H22N8S2 and a molecular weight of 342.50 g/mol. Its IUPAC name is (1R)-2-[[(2R)-2-amino-2-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]disulfanyl]-1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | (1R)-2-[[(2R)-2-amino-2-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]disulfanyl]-1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 90193582 |
| Molecular Formula | C12H22N8S2 |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (1R)-2-[[(2R)-2-amino-2-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]disulfanyl]-1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanamine |
| SMILES | CCc1nc([C@@H](N)CSSC[C@H](N)c2n[nH]c(CC)n2)n[nH]1 |
| InChI | InChI=1S/C12H22N8S2/c1-3-9-15-11(19-17-9)7(13)5-21-22-6-8(14)12-16-10(4-2)18-20-12/h7-8H,3-6,13-14H2,1-2H3,(H,15,17,19)(H,16,18,20)/t7-,8-/m0/s1 |
| InChIKey | IWJMPUPLKCQKFE-YUMQZZPRSA-N |
| XLogP | 1.13 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|