C8H14N8S2 — CID 90193593
(1R)-2-[[(2R)-2-amino-2-(1H-1,2,4-triazol-5-yl)ethyl]disulfanyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 90193593) has the molecular formula C8H14N8S2 and a molecular weight of 286.39 g/mol. Its IUPAC name is (1R)-2-[[(2R)-2-amino-2-(1H-1,2,4-triazol-5-yl)ethyl]disulfanyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | (1R)-2-[[(2R)-2-amino-2-(1H-1,2,4-triazol-5-yl)ethyl]disulfanyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 90193593 |
| Molecular Formula | C8H14N8S2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (1R)-2-[[(2R)-2-amino-2-(1H-1,2,4-triazol-5-yl)ethyl]disulfanyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | N[C@@H](CSSC[C@H](N)c1ncn[nH]1)c1ncn[nH]1 |
| InChI | InChI=1S/C8H14N8S2/c9-5(7-11-3-13-15-7)1-17-18-2-6(10)8-12-4-14-16-8/h3-6H,1-2,9-10H2,(H,11,13,15)(H,12,14,16)/t5-,6-/m0/s1 |
| InChIKey | YIPVEDYOQPYBDW-WDSKDSINSA-N |
| XLogP | 0.00 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|