C15H25N5O3S2 — CID 90193597
(3R)-3-[[[(2R)-2-amino-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]disulfanyl]methyl]-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 90193597) has the molecular formula C15H25N5O3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is (3R)-3-[[[(2R)-2-amino-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]disulfanyl]methyl]-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | (3R)-3-[[[(2R)-2-amino-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]disulfanyl]methyl]-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 90193597 |
| Molecular Formula | C15H25N5O3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (3R)-3-[[[(2R)-2-amino-2-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)ethyl]disulfanyl]methyl]-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)c1noc([C@@H](N)CSSC[C@@H]2NC(=O)C(C(C)C)NC2=O)n1 |
| InChI | InChI=1S/C15H25N5O3S2/c1-7(2)11-14(22)17-10(13(21)18-11)6-25-24-5-9(16)15-19-12(8(3)4)20-23-15/h7-11H,5-6,16H2,1-4H3,(H,17,22)(H,18,21)/t9-,10-,11?/m0/s1 |
| InChIKey | SNLVRKLHVNBVOH-QRHSGQBVSA-N |
| XLogP | 1.21 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|