C47H49Br2N3 — CID 90193784
2,4-bis[4-[4-(4-bromophenyl)butyl]phenyl]-6-(4-hexylphenyl)-1,3,5-triazine (PubChem CID 90193784) has the molecular formula C47H49Br2N3 and a molecular weight of 815.74 g/mol. Its IUPAC name is 2,4-bis[4-[4-(4-bromophenyl)butyl]phenyl]-6-(4-hexylphenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis[4-[4-(4-bromophenyl)butyl]phenyl]-6-(4-hexylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 90193784 |
| Molecular Formula | C47H49Br2N3 |
| Molecular Weight | 815.74 g/mol |
| Exact Mass | 813.23 |
| IUPAC Name | 2,4-bis[4-[4-(4-bromophenyl)butyl]phenyl]-6-(4-hexylphenyl)-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(-c2nc(-c3ccc(CCCCc4ccc(Br)cc4)cc3)nc(-c3ccc(CCCCc4ccc(Br)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C47H49Br2N3/c1-2-3-4-5-10-35-15-25-40(26-16-35)45-50-46(41-27-17-36(18-28-41)11-6-8-13-38-21-31-43(48)32-22-38)52-47(51-45)42-29-19-37(20-30-42)12-7-9-14-39-23-33-44(49)34-24-39/h15-34H,2-14H2,1H3 |
| InChIKey | PUDTVCRQCFRSNQ-UHFFFAOYSA-N |
| XLogP | 13.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.74 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|