C82H60N4Si3 — CID 90193795
diphenyl-bis[3-(8-triphenylsilylpyrido[3,2-b]indol-5-yl)phenyl]silane (PubChem CID 90193795) has the molecular formula C82H60N4Si3 and a molecular weight of 1185.67 g/mol. Its IUPAC name is diphenyl-bis[3-(8-triphenylsilylpyrido[3,2-b]indol-5-yl)phenyl]silane.
| Compound Name | diphenyl-bis[3-(8-triphenylsilylpyrido[3,2-b]indol-5-yl)phenyl]silane |
|---|---|
| PubChem CID | 90193795 |
| Molecular Formula | C82H60N4Si3 |
| Molecular Weight | 1185.67 g/mol |
| Exact Mass | 1184.41 |
| IUPAC Name | diphenyl-bis[3-(8-triphenylsilylpyrido[3,2-b]indol-5-yl)phenyl]silane |
| SMILES | c1ccc([Si](c2ccccc2)(c2cccc(-n3c4ccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)cc4c4ncccc43)c2)c2cccc(-n3c4ccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)cc4c4ncccc43)c2)cc1 |
| InChI | InChI=1S/C82H60N4Si3/c1-9-31-63(32-10-1)87(64-33-11-2-12-34-64,65-35-13-3-14-36-65)73-51-53-77-75(59-73)81-79(49-27-55-83-81)85(77)61-29-25-47-71(57-61)89(69-43-21-7-22-44-69,70-45-23-8-24-46-70)72-48-26-30-62(58-72)86-78-54-52-74(60-76(78)82-80(86)50-28-56-84-82)88(66-37-15-4-16-38-66,67-39-17-5-18-40-67)68-41-19-6-20-42-68/h1-60H |
| InChIKey | YTDMARZANIHDIA-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1185.67 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|