C48H28F6N2 — CID 90193946
4-(7,9-diphenylcarbazol-3-yl)-N-(4-fluorophenyl)-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline (PubChem CID 90193946) has the molecular formula C48H28F6N2 and a molecular weight of 746.75 g/mol. Its IUPAC name is 4-(7,9-diphenylcarbazol-3-yl)-N-(4-fluorophenyl)-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline.
| Compound Name | 4-(7,9-diphenylcarbazol-3-yl)-N-(4-fluorophenyl)-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 90193946 |
| Molecular Formula | C48H28F6N2 |
| Molecular Weight | 746.75 g/mol |
| Exact Mass | 746.22 |
| IUPAC Name | 4-(7,9-diphenylcarbazol-3-yl)-N-(4-fluorophenyl)-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline |
| SMILES | Fc1ccc(N(c2ccc(-c3ccc4c(c3)c3ccc(-c5ccccc5)cc3n4-c3ccccc3)cc2)c2ccc(-c3c(F)c(F)c(F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C48H28F6N2/c49-34-17-23-38(24-18-34)55(37-21-13-31(14-22-37)43-44(50)46(52)48(54)47(53)45(43)51)36-19-11-30(12-20-36)32-16-26-41-40(27-32)39-25-15-33(29-7-3-1-4-8-29)28-42(39)56(41)35-9-5-2-6-10-35/h1-28H |
| InChIKey | WPCACKFBMUFRGJ-UHFFFAOYSA-N |
| XLogP | 14.09 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.75 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|