C56H32F6N2S — CID 90193962
N-[4-[6-(1-benzothiophen-2-yl)-9-phenylcarbazol-3-yl]phenyl]-4-(4-fluorophenyl)-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline (PubChem CID 90193962) has the molecular formula C56H32F6N2S and a molecular weight of 878.94 g/mol. Its IUPAC name is N-[4-[6-(1-benzothiophen-2-yl)-9-phenylcarbazol-3-yl]phenyl]-4-(4-fluorophenyl)-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline.
| Compound Name | N-[4-[6-(1-benzothiophen-2-yl)-9-phenylcarbazol-3-yl]phenyl]-4-(4-fluorophenyl)-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 90193962 |
| Molecular Formula | C56H32F6N2S |
| Molecular Weight | 878.94 g/mol |
| Exact Mass | 878.22 |
| IUPAC Name | N-[4-[6-(1-benzothiophen-2-yl)-9-phenylcarbazol-3-yl]phenyl]-4-(4-fluorophenyl)-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline |
| SMILES | Fc1ccc(-c2ccc(N(c3ccc(-c4ccc5c(c4)c4cc(-c6cc7ccccc7s6)ccc4n5-c4ccccc4)cc3)c3ccc(-c4c(F)c(F)c(F)c(F)c4F)cc3)cc2)cc1 |
| InChI | InChI=1S/C56H32F6N2S/c57-40-20-10-33(11-21-40)34-12-22-42(23-13-34)63(44-26-16-36(17-27-44)51-52(58)54(60)56(62)55(61)53(51)59)43-24-14-35(15-25-43)37-18-28-47-45(30-37)46-31-39(50-32-38-6-4-5-9-49(38)65-50)19-29-48(46)64(47)41-7-2-1-3-8-41/h1-32H |
| InChIKey | ULAHXBWZAUMCAE-UHFFFAOYSA-N |
| XLogP | 16.97 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.94 |
| LogP ≤ 5 | 16.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|