C56H33F5N2S — CID 90193973
N-[4-[6-(1-benzothiophen-2-yl)-9-phenylcarbazol-3-yl]phenyl]-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-4-phenylaniline (PubChem CID 90193973) has the molecular formula C56H33F5N2S and a molecular weight of 860.95 g/mol. Its IUPAC name is N-[4-[6-(1-benzothiophen-2-yl)-9-phenylcarbazol-3-yl]phenyl]-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-4-phenylaniline.
| Compound Name | N-[4-[6-(1-benzothiophen-2-yl)-9-phenylcarbazol-3-yl]phenyl]-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 90193973 |
| Molecular Formula | C56H33F5N2S |
| Molecular Weight | 860.95 g/mol |
| Exact Mass | 860.23 |
| IUPAC Name | N-[4-[6-(1-benzothiophen-2-yl)-9-phenylcarbazol-3-yl]phenyl]-N-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-4-phenylaniline |
| SMILES | Fc1c(F)c(F)c(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccc5c(c4)c4cc(-c6cc7ccccc7s6)ccc4n5-c4ccccc4)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C56H33F5N2S/c57-52-51(53(58)55(60)56(61)54(52)59)37-19-27-44(28-20-37)62(42-23-15-35(16-24-42)34-9-3-1-4-10-34)43-25-17-36(18-26-43)38-21-29-47-45(31-38)46-32-40(50-33-39-11-7-8-14-49(39)64-50)22-30-48(46)63(47)41-12-5-2-6-13-41/h1-33H |
| InChIKey | SVVSUQFYMKKKRP-UHFFFAOYSA-N |
| XLogP | 16.83 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.95 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|