C24H30S2 — CID 90194983
2,3,4-trimethyl-5-[2,3,5,6-tetramethyl-4-(3,4,5-trimethylthiophen-2-yl)phenyl]thiophene (PubChem CID 90194983) has the molecular formula C24H30S2 and a molecular weight of 382.64 g/mol. Its IUPAC name is 2,3,4-trimethyl-5-[2,3,5,6-tetramethyl-4-(3,4,5-trimethylthiophen-2-yl)phenyl]thiophene.
| Compound Name | 2,3,4-trimethyl-5-[2,3,5,6-tetramethyl-4-(3,4,5-trimethylthiophen-2-yl)phenyl]thiophene |
|---|---|
| PubChem CID | 90194983 |
| Molecular Formula | C24H30S2 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2,3,4-trimethyl-5-[2,3,5,6-tetramethyl-4-(3,4,5-trimethylthiophen-2-yl)phenyl]thiophene |
| SMILES | Cc1sc(-c2c(C)c(C)c(-c3sc(C)c(C)c3C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C24H30S2/c1-11-17(7)23(25-19(11)9)21-13(3)15(5)22(16(6)14(21)4)24-18(8)12(2)20(10)26-24/h1-10H3 |
| InChIKey | YFACLNCJAORDBN-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |