C11H21NO6 — CID 90195838
N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pent-4-enamide (PubChem CID 90195838) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pent-4-enamide.
| Compound Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pent-4-enamide |
|---|---|
| PubChem CID | 90195838 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]pent-4-enamide |
| SMILES | C=CCCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H21NO6/c1-2-3-4-9(16)12-5-7(14)10(17)11(18)8(15)6-13/h2,7-8,10-11,13-15,17-18H,1,3-6H2,(H,12,16)/t7-,8+,10+,11+/m0/s1 |
| InChIKey | MCUSRRBZGNDTHM-SCVMZPAESA-N |
| XLogP | -2.50 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|