C24H25F3O3S — CID 90196378
6-methyl-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione (PubChem CID 90196378) has the molecular formula C24H25F3O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is 6-methyl-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione.
| Compound Name | 6-methyl-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 90196378 |
| Molecular Formula | C24H25F3O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 6-methyl-6-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(C)(CCSc3ccc(C(F)(F)F)cc3)OC2=O)c(C)c1 |
| InChI | InChI=1S/C24H25F3O3S/c1-14-11-15(2)20(16(3)12-14)21-19(28)13-23(4,30-22(21)29)9-10-31-18-7-5-17(6-8-18)24(25,26)27/h5-8,11-12,21H,9-10,13H2,1-4H3 |
| InChIKey | AROZOTMFKFODAG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|