About 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide
2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide (PubChem CID 90196811) has the molecular formula C12H19N3O6
and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide.
Molecular Properties
| Compound Name | 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide |
| PubChem CID | 90196811 |
| Molecular Formula | C12H19N3O6 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide |
| SMILES | NOCC(=O)NCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H19N3O6/c13-21-9-10(16)14-3-5-19-7-8-20-6-4-15-11(17)1-2-12(15)18/h1-2H,3-9,13H2,(H,14,16) |
| InChIKey | NNAIUZBACWYHTO-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide?
The IUPAC name of 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide (CID 90196811) is 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide.
What is the SMILES notation for 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide?
The canonical SMILES for 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide is NOCC(=O)NCCOCCOCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide?
The InChIKey is NNAIUZBACWYHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O6/c13-21-9-10(16)14-3-5-19-7-8-20-6-4-15-11(17)1-2-12(15)18/h1-2H,3-9,13H2,(H,14,16).
What are the key properties of 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide?
2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide has a molecular weight of 301.30 g/mol, XLogP of -2.05, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooxy-N-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethyl]acetamide is sourced from PubChem (CID 90196811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).