About 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride
3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride (PubChem CID 90198193) has the molecular formula C20H28ClNO7
and a molecular weight of 429.90 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride |
| PubChem CID | 90198193 |
| Molecular Formula | C20H28ClNO7 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride |
| SMILES | Cl.O=C(OCCCC1OCCO1)C1CCNCC1.O=Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H21NO4.C8H6O3.ClH/c14-12(10-3-5-13-6-4-10)17-7-1-2-11-15-8-9-16-11;9-5-6-1-3-7(4-2-6)8(10)11;/h10-11,13H,1-9H2;1-5H,(H,10,11);1H |
| InChIKey | SSDHBGLPUHQZFS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride?
The IUPAC name of 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride (CID 90198193) is 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride.
What is the SMILES notation for 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride?
The canonical SMILES for 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride is Cl.O=C(OCCCC1OCCO1)C1CCNCC1.O=Cc1ccc(C(=O)O)cc1.
What is the InChIKey of 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride?
The InChIKey is SSDHBGLPUHQZFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4.C8H6O3.ClH/c14-12(10-3-5-13-6-4-10)17-7-1-2-11-15-8-9-16-11;9-5-6-1-3-7(4-2-6)8(10)11;/h10-11,13H,1-9H2;1-5H,(H,10,11);1H.
What are the key properties of 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride?
3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride has a molecular weight of 429.90 g/mol, XLogP of 2.30, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxolan-2-yl)propyl piperidine-4-carboxylate;4-formylbenzoic acid;hydrochloride is sourced from PubChem (CID 90198193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).