C20H20N2O4 — CID 9019829
methyl 4-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]amino]butanoate (PubChem CID 9019829) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl 4-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 9019829 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | methyl 4-[[2-[4-(4-cyanophenyl)phenoxy]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)COc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-25-20(24)3-2-12-22-19(23)14-26-18-10-8-17(9-11-18)16-6-4-15(13-21)5-7-16/h4-11H,2-3,12,14H2,1H3,(H,22,23) |
| InChIKey | GMYKBLPETSPDOA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|